Products 1558138-88-7

CAS 1558138-88-7 is the registry number for 3-Cyanopyrazolo(1,5-a)pyrimidine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-cyanopyrazolo[1,5-a]pyrimidine-6-carboxylic acid (CAS 1558138-88-7) is a chemical compound with the molecular formula C8H4N4O2 and a molecular weight of 188.14 g/mol. IUPAC name: 3-cyanopyrazolo[1,5-a]pyrimidine-6-carboxylic acid. InChIKey: AYSXXJSJRSRZQO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4N4O2
Molecular weight188.14 g/mol
IUPAC name3-cyanopyrazolo[1,5-a]pyrimidine-6-carboxylic acid
InChIKeyAYSXXJSJRSRZQO-UHFFFAOYSA-N
SMILESC1=C(C=NC2=C(C=NN21)C#N)C(=O)O

Computed by PubChem (NCBI)