CAS 1558138-88-7 is the registry number for 3-Cyanopyrazolo(1,5-a)pyrimidine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-cyanopyrazolo[1,5-a]pyrimidine-6-carboxylic acid (CAS 1558138-88-7) is a chemical compound with the molecular formula C8H4N4O2 and a molecular weight of 188.14 g/mol. IUPAC name: 3-cyanopyrazolo[1,5-a]pyrimidine-6-carboxylic acid. InChIKey: AYSXXJSJRSRZQO-UHFFFAOYSA-N.
| Molecular formula | C8H4N4O2 |
|---|---|
| Molecular weight | 188.14 g/mol |
| IUPAC name | 3-cyanopyrazolo[1,5-a]pyrimidine-6-carboxylic acid |
| InChIKey | AYSXXJSJRSRZQO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C(C=NN21)C#N)C(=O)O |
Computed by PubChem (NCBI)