CAS 79711-73-2 appears in our catalog under these names: 1,4,7,10-Tetraazatricyclo[7.3.0.0,3,7]dodeca-3,5,9,11-tetraene-2,8-dione, 95%, 5H,10H-Diimidazo(1,2-a:1',2'-d)pyrazine-5,10-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1,4,7,10-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione (CAS 79711-73-2) is a chemical compound with the molecular formula C8H4N4O2 and a molecular weight of 188.14 g/mol. IUPAC name: 1,4,7,10-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione. InChIKey: SCHCQSDINJJQCW-UHFFFAOYSA-N.
| Molecular formula | C8H4N4O2 |
|---|---|
| Molecular weight | 188.14 g/mol |
| IUPAC name | 1,4,7,10-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione |
| InChIKey | SCHCQSDINJJQCW-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=N1)C(=O)N3C=CN=C3C2=O |
Computed by PubChem (NCBI)