CAS 79319-38-3 is the registry number for 4-Amino-5-nitrophthalonitrile. Offered by: TRC. Available pack sizes: 2,5g.
4-amino-5-nitrobenzene-1,2-dicarbonitrile (CAS 79319-38-3) is a chemical compound with the molecular formula C8H4N4O2 and a molecular weight of 188.14 g/mol. IUPAC name: 4-amino-5-nitrobenzene-1,2-dicarbonitrile. InChIKey: IBTXCLAXNPIBPB-UHFFFAOYSA-N.
| Molecular formula | C8H4N4O2 |
|---|---|
| Molecular weight | 188.14 g/mol |
| IUPAC name | 4-amino-5-nitrobenzene-1,2-dicarbonitrile |
| InChIKey | IBTXCLAXNPIBPB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)[N+](=O)[O-])C#N)C#N |
Computed by PubChem (NCBI)