CAS 53525-65-8 appears in our catalog under these names: 5H,10H-Diimidazo[1,5-a:1',5'-d]pyrazine-5,10-dione, 96%, Diimidazo(1,5–a:1',5'–d)pyrazine–5,10–dione, Diimidazo[1,5-a:1',5'-d]pyrazine-5,10-dione 95%, Diimidazo[1,5-a:1',5'-d]pyrazine-5,10-dione, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione (CAS 53525-65-8) is a chemical compound with the molecular formula C8H4N4O2 and a molecular weight of 188.14 g/mol. IUPAC name: 1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione. InChIKey: UYAAVKFHBMJOJZ-UHFFFAOYSA-N.
| Molecular formula | C8H4N4O2 |
|---|---|
| Molecular weight | 188.14 g/mol |
| IUPAC name | 1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione |
| InChIKey | UYAAVKFHBMJOJZ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=O)N3C=NC=C3C(=O)N2C=N1 |
Computed by PubChem (NCBI)