Products 1558780-60-1
CAS 1558780-60-1 is the registry number for 1-benzyl-3-bromo-piperidine-2,6-dione, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-benzyl-3-bromopiperidine-2,6-dione (CAS 1558780-60-1) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: 1-benzyl-3-bromopiperidine-2,6-dione. InChIKey: KLQZVTLFONYFKK-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 1-benzyl-3-bromopiperidine-2,6-dione |
| InChIKey | KLQZVTLFONYFKK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C(=O)C1Br)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)