CAS 155908-58-0 is the registry number for 3-(2,2,2-Trifluoroethoxy)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(2,2,2-trifluoroethoxy)benzaldehyde (CAS 155908-58-0) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)benzaldehyde. InChIKey: VXNUKVSIHDRZRA-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)benzaldehyde |
| InChIKey | VXNUKVSIHDRZRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)C=O |
Computed by PubChem (NCBI)