Products 156086-78-1
CAS 156086-78-1 is the registry number for 6,13-Dimethyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6,13-dimethyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one (CAS 156086-78-1) is a chemical compound with the molecular formula C17H14O and a molecular weight of 234.29 g/mol. IUPAC name: 6,13-dimethyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one. InChIKey: JZIHQHZFQCEZRO-UHFFFAOYSA-N.
| Molecular formula | C17H14O |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 6,13-dimethyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
| InChIKey | JZIHQHZFQCEZRO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)C3=C(C=C2)C=C(C=C3)C |
Computed by PubChem (NCBI)