CAS 156136-70-8 is the registry number for 6-Chloro-1-methyl-2,3-dihydro-1H-indole-2-thione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-1-methyl-3H-indole-2-thione (CAS 156136-70-8) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: 6-chloro-1-methyl-3H-indole-2-thione. InChIKey: JEXOQFIGJMQONR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | 6-chloro-1-methyl-3H-indole-2-thione |
| InChIKey | JEXOQFIGJMQONR-UHFFFAOYSA-N |
| SMILES | CN1C(=S)CC2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)