CAS 156274-31-6 is the registry number for Methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate (CAS 156274-31-6) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate. InChIKey: VRCWDZZOUSAXIH-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate |
| InChIKey | VRCWDZZOUSAXIH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CS1)C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)