CAS 156276-22-1 appears in our catalog under these names: Methyl 2-hydroxy-2-(4-(trifluoromethyl)phenyl)acetate, 95%, Methyl 2-hydroxy-2-(4-(trifluoromethyl)phenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Methyl 2-hydroxy-2-[4-(trifluoromethyl)phenyl]acetate (CAS 156276-22-1) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: methyl 2-hydroxy-2-[4-(trifluoromethyl)phenyl]acetate. InChIKey: ANLYXIOQZYHUAE-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | methyl 2-hydroxy-2-[4-(trifluoromethyl)phenyl]acetate |
| InChIKey | ANLYXIOQZYHUAE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)