Products 156281-11-7

CAS 156281-11-7 is the registry number for 4-(tert-Butoxycarbonyloxy)benzylalcohol. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Tert-butyl [4-(hydroxymethyl)phenyl] carbonate (CAS 156281-11-7) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: tert-butyl [4-(hydroxymethyl)phenyl] carbonate. InChIKey: BFOWSYHQIDOYPX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O4
Molecular weight224.25 g/mol
IUPAC nametert-butyl [4-(hydroxymethyl)phenyl] carbonate
InChIKeyBFOWSYHQIDOYPX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)OC1=CC=C(C=C1)CO

Computed by PubChem (NCBI)