CAS 1564266-26-7 appears in our catalog under these names: Boc-D-Gly(adamantyl)-OH, (R)-2-((3R,5R,7R)-Adamantan-1-yl)-2-((tert-butoxycarbonyl)amino)acetic acid. Offered by: Iris Biotech, Biosynth. Available pack sizes: 5g, 250mg, 100mg, 500mg.
(2R)-2-(1-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1564266-26-7) is a chemical compound with the molecular formula C17H27NO4 and a molecular weight of 309.4 g/mol. IUPAC name: (2R)-2-(1-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: LJUATQZYDYSZPV-RQYMUSGFSA-N.
| Molecular formula | C17H27NO4 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (2R)-2-(1-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | LJUATQZYDYSZPV-RQYMUSGFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(=O)O)C12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)