CAS 1564471-90-4 appears in our catalog under these names: (3-Fluoro-4-methanesulfonylphenyl)methanol, 95%, 3-Fluoro-4-(methylsulphonyl)benzyl alcohol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
(3-fluoro-4-methylsulfonylphenyl)methanol (CAS 1564471-90-4) is a chemical compound with the molecular formula C8H9FO3S and a molecular weight of 204.22 g/mol. IUPAC name: (3-fluoro-4-methylsulfonylphenyl)methanol. InChIKey: BYAGEYXOLPQUAU-UHFFFAOYSA-N.
| Molecular formula | C8H9FO3S |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (3-fluoro-4-methylsulfonylphenyl)methanol |
| InChIKey | BYAGEYXOLPQUAU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)CO)F |
Computed by PubChem (NCBI)