CAS 2138429-02-2 is the registry number for 4,5,6,7-Tetrahydrobenzofuran-2-sulfonyl fluoride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4,5,6,7-tetrahydro-1-benzofuran-2-sulfonyl fluoride (CAS 2138429-02-2) is a chemical compound with the molecular formula C8H9FO3S and a molecular weight of 204.22 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1-benzofuran-2-sulfonyl fluoride. InChIKey: OLNATVGCUJEHMT-UHFFFAOYSA-N.
| Molecular formula | C8H9FO3S |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1-benzofuran-2-sulfonyl fluoride |
| InChIKey | OLNATVGCUJEHMT-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=C(O2)S(=O)(=O)F |
Computed by PubChem (NCBI)