CAS 1892495-27-0 is the registry number for (4-Methoxyphenyl)methanesulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(4-methoxyphenyl)methanesulfonyl fluoride (CAS 1892495-27-0) is a chemical compound with the molecular formula C8H9FO3S and a molecular weight of 204.22 g/mol. IUPAC name: (4-methoxyphenyl)methanesulfonyl fluoride. InChIKey: CZWBDCOSNUSOIL-UHFFFAOYSA-N.
| Molecular formula | C8H9FO3S |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (4-methoxyphenyl)methanesulfonyl fluoride |
| InChIKey | CZWBDCOSNUSOIL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CS(=O)(=O)F |
Computed by PubChem (NCBI)