Products 1888955-84-7
CAS 1888955-84-7 is the registry number for 2-(4-Hydroxyphenyl)ethane-1-sulfonyl fluoride 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-(4-hydroxyphenyl)ethanesulfonyl fluoride (CAS 1888955-84-7) is a chemical compound with the molecular formula C8H9FO3S and a molecular weight of 204.22 g/mol. IUPAC name: 2-(4-hydroxyphenyl)ethanesulfonyl fluoride. InChIKey: YVGFHAZTQINNRD-UHFFFAOYSA-N.
| Molecular formula | C8H9FO3S |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)ethanesulfonyl fluoride |
| InChIKey | YVGFHAZTQINNRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCS(=O)(=O)F)O |
Computed by PubChem (NCBI)