Products 15647-47-9
CAS 15647-47-9 appears in our catalog under these names: 5-(Benzoylamino)valeric acid, 98%, 5-Benzamidopentanoic acid, 95%, 5-(Benzoylamino)valeric Acid, 5-(Benzoylamino)valeric Acid, >98.0%(GC)(T), 5-Benzamidopentanoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, TCI, Chemat. Available pack sizes: 100mg, 5g, 1g, 2,5g, 250mg, 25g.
5-benzamidopentanoic acid (CAS 15647-47-9) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 5-benzamidopentanoic acid. InChIKey: LAPZULVOGQPDBE-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 5-benzamidopentanoic acid |
| InChIKey | LAPZULVOGQPDBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-(Benzoylamino)pentanoic acid, 5-benzamidopentanoic acid, 5-(Benzoylamino)valeric Acid, 5-Benzamidovaleric acid, Pentanoic acid, 5-(benzoylamino)-, 5-(N-benzoylamino)-n-valeri acid, 5-(phenylformamido)pentanoic acid, 5-(Benzoylamino)-N-Valeric Acid, Benzoylaminovaleriacid, LAPZULVOGQPDBE-UHFFFAOYSA-