CAS 1564879-12-4 is the registry number for 2-Propynoic acid, 3-(3-methyltricyclo[3.3.1.13,7]dec-1-yl)-, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-methyl-1-adamantyl)prop-2-ynoic acid (CAS 1564879-12-4) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: 3-(3-methyl-1-adamantyl)prop-2-ynoic acid. InChIKey: TZDVHSVCONTSKM-UHFFFAOYSA-N.
| Molecular formula | C14H18O2 |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 3-(3-methyl-1-adamantyl)prop-2-ynoic acid |
| InChIKey | TZDVHSVCONTSKM-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)CC(C3)(C2)C#CC(=O)O |
Computed by PubChem (NCBI)