Products 1564879-12-4

CAS 1564879-12-4 is the registry number for 2-Propynoic acid, 3-(3-methyltricyclo[3.3.1.13,7]dec-1-yl)-, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-methyl-1-adamantyl)prop-2-ynoic acid (CAS 1564879-12-4) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: 3-(3-methyl-1-adamantyl)prop-2-ynoic acid. InChIKey: TZDVHSVCONTSKM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O2
Molecular weight218.29 g/mol
IUPAC name3-(3-methyl-1-adamantyl)prop-2-ynoic acid
InChIKeyTZDVHSVCONTSKM-UHFFFAOYSA-N
SMILESCC12CC3CC(C1)CC(C3)(C2)C#CC(=O)O

Computed by PubChem (NCBI)