Products 1565102-53-5
CAS 1565102-53-5 appears in our catalog under these names: 6-Fluoro-2-methyl-1H-benzo(d)imidazole-5-carboxylic acid, 97%, 6-Fluoro-2-methyl-1H-1,3-benzodiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-fluoro-2-methyl-1H-benzimidazole-5-carboxylic acid (CAS 1565102-53-5) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: 6-fluoro-2-methyl-1H-benzimidazole-5-carboxylic acid. InChIKey: XYQXKHCXNTVFLU-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | 6-fluoro-2-methyl-1H-benzimidazole-5-carboxylic acid |
| InChIKey | XYQXKHCXNTVFLU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C(=C2)C(=O)O)F |
Computed by PubChem (NCBI)