Products 1565505-51-2
CAS 1565505-51-2 is the registry number for 2,3,7-Trimethylpyrazolo[1,5-a]pyrimidin-5(4H)-one, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2,3,7-trimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one (CAS 1565505-51-2) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 2,3,7-trimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one. InChIKey: ZOEJSYBBZPMLSE-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 2,3,7-trimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| InChIKey | ZOEJSYBBZPMLSE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C(C(=NN12)C)C |
Computed by PubChem (NCBI)