CAS 1565827-84-0 is the registry number for Ethyl 5-(3,5-dichlorophenyl)-1-methyl-1h-pyrazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 5-(3,5-dichlorophenyl)-1-methylpyrazole-3-carboxylate (CAS 1565827-84-0) is a chemical compound with the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.15 g/mol. IUPAC name: ethyl 5-(3,5-dichlorophenyl)-1-methylpyrazole-3-carboxylate. InChIKey: BUKFPOSTEKJGKG-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O2 |
|---|---|
| Molecular weight | 299.15 g/mol |
| IUPAC name | ethyl 5-(3,5-dichlorophenyl)-1-methylpyrazole-3-carboxylate |
| InChIKey | BUKFPOSTEKJGKG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=C1)C2=CC(=CC(=C2)Cl)Cl)C |
Computed by PubChem (NCBI)