CAS 926269-51-4 appears in our catalog under these names: [1-(3,4-Dichlorophenyl)-3,5-dimethyl-1h-pyrazol-4-yl]acetic acid, 95%, 2-(1-(3,4-Dichlorophenyl)-3,5-dimethyl-1H-pyrazol-4-yl)acetic acid, 95%, 2-(1-(3,4-Dichlorophenyl)-3,5-dimethyl-1H-pyrazol-4-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]acetic acid (CAS 926269-51-4) is a chemical compound with the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.15 g/mol. IUPAC name: 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]acetic acid. InChIKey: ZXBAIKNVFZPFAM-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O2 |
|---|---|
| Molecular weight | 299.15 g/mol |
| IUPAC name | 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]acetic acid |
| InChIKey | ZXBAIKNVFZPFAM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC(=C(C=C2)Cl)Cl)C)CC(=O)O |
Computed by PubChem (NCBI)