CAS 1881293-52-2 is the registry number for N-benzyl-3-chloro-5-nitroaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-benzyl-3-chloro-5-nitroaniline;hydrochloride (CAS 1881293-52-2) is a chemical compound with the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.15 g/mol. IUPAC name: N-benzyl-3-chloro-5-nitroaniline;hydrochloride. InChIKey: CUUOMOFJJIBTCB-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O2 |
|---|---|
| Molecular weight | 299.15 g/mol |
| IUPAC name | N-benzyl-3-chloro-5-nitroaniline;hydrochloride |
| InChIKey | CUUOMOFJJIBTCB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC(=CC(=C2)Cl)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)