CAS 306936-60-7 appears in our catalog under these names: 1-(3,5-Dichlorophenyl)-5-propyl-1h-pyrazole-4-carboxylic acid, 95%, 1-(3,5-Dichlorophenyl)-5-propyl-1H-pyrazole-4-carboxylic acid, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250mg, 10g.
1-(3,5-dichlorophenyl)-5-propylpyrazole-4-carboxylic acid (CAS 306936-60-7) is a chemical compound with the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.15 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-5-propylpyrazole-4-carboxylic acid. InChIKey: CIAUICOJDLJNBL-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O2 |
|---|---|
| Molecular weight | 299.15 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-5-propylpyrazole-4-carboxylic acid |
| InChIKey | CIAUICOJDLJNBL-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C=NN1C2=CC(=CC(=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)