Products 1566158-53-9

CAS 1566158-53-9 is the registry number for 2-(3,5-Dioxothiomorpholin-4-yl)pent-4-ynoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(3,5-dioxothiomorpholin-4-yl)pent-4-ynoic acid (CAS 1566158-53-9) is a chemical compound with the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. IUPAC name: 2-(3,5-dioxothiomorpholin-4-yl)pent-4-ynoic acid. InChIKey: WEVLPFYELVMCEF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO4S
Molecular weight227.24 g/mol
IUPAC name2-(3,5-dioxothiomorpholin-4-yl)pent-4-ynoic acid
InChIKeyWEVLPFYELVMCEF-UHFFFAOYSA-N
SMILESC#CCC(C(=O)O)N1C(=O)CSCC1=O

Computed by PubChem (NCBI)