Products 2271443-87-7
CAS 2271443-87-7 appears in our catalog under these names: Carbazochrome Impurity 7, Carbazochrome Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
6-hydroxy-1-methylindole-2-sulfonic acid (CAS 2271443-87-7) is a chemical compound with the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. IUPAC name: 6-hydroxy-1-methylindole-2-sulfonic acid. InChIKey: DKPDCIWNAFWJNO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 6-hydroxy-1-methylindole-2-sulfonic acid |
| InChIKey | DKPDCIWNAFWJNO-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=C1C=C(C=C2)O)S(=O)(=O)O |
Computed by PubChem (NCBI)