Products 6345-13-7
CAS 6345-13-7 is the registry number for [(4-Nitrobenzyl)thio]acetic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
2-[(4-nitrophenyl)methylsulfanyl]acetic acid (CAS 6345-13-7) is a chemical compound with the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. IUPAC name: 2-[(4-nitrophenyl)methylsulfanyl]acetic acid. InChIKey: VBACFDMVHJLUGP-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 2-[(4-nitrophenyl)methylsulfanyl]acetic acid |
| InChIKey | VBACFDMVHJLUGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
[(4-nitrobenzyl)thio]acetic acid, 2-[(4-nitrophenyl)methylsulfanyl]acetic acid, [(4-nitrobenzyl)sulfanyl]acetic acid, 2-{[(4-nitrophenyl)methyl]sulfanyl}acetic acid, 2-((4-nitrobenzyl)thio)acetic acid, Acetic acid, [[(4-nitrophenyl)methyl]thio]-, (4-nitrobenzylthio)acetic acid, {[(4-nitrophenyl)methyl]sulfanyl}acetic acid, Cambridge id 5325025, 2-((4-nitrobenzyl)thio)aceticacid