CAS 286472-02-4 appears in our catalog under these names: 2-[(2-Carboxyethyl)sulfanyl]nicotinic acid, 95%, 2–((2–carboxyethyl)thio)nicotinic acid, 2-((2-Carboxyethyl)thio)nicotinic acid 97%, 2-((2-carboxyethyl)thio)nicotinic acid, 97%, 97%, 2-((2-CARBOXYETHYL)THIO)NICOTINIC ACID, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-(2-carboxyethylsulfanyl)pyridine-3-carboxylic acid (CAS 286472-02-4) is a chemical compound with the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. IUPAC name: 2-(2-carboxyethylsulfanyl)pyridine-3-carboxylic acid. InChIKey: BECQKEAJAOJORW-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 2-(2-carboxyethylsulfanyl)pyridine-3-carboxylic acid |
| InChIKey | BECQKEAJAOJORW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)SCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)