Products 1566537-63-0

CAS 1566537-63-0 appears in our catalog under these names: (4,4-Difluorocyclohexyl)methanesulfonyl chloride, 95%, (4,4-Difluorocyclohexyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

(4,4-difluorocyclohexyl)methanesulfonyl chloride (CAS 1566537-63-0) is a chemical compound with the molecular formula C7H11ClF2O2S and a molecular weight of 232.68 g/mol. IUPAC name: (4,4-difluorocyclohexyl)methanesulfonyl chloride. InChIKey: IGJWGORKZDBDCH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClF2O2S
Molecular weight232.68 g/mol
IUPAC name(4,4-difluorocyclohexyl)methanesulfonyl chloride
InChIKeyIGJWGORKZDBDCH-UHFFFAOYSA-N
SMILESC1CC(CCC1CS(=O)(=O)Cl)(F)F

Computed by PubChem (NCBI)