CAS 1784380-35-3 appears in our catalog under these names: (2,2-Difluorocyclohexyl)methanesulfonyl chloride, 95%, (2,2-Difluorocyclohexyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2,2-difluorocyclohexyl)methanesulfonyl chloride (CAS 1784380-35-3) is a chemical compound with the molecular formula C7H11ClF2O2S and a molecular weight of 232.68 g/mol. IUPAC name: (2,2-difluorocyclohexyl)methanesulfonyl chloride. InChIKey: UXNSGUYHCFUCJM-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF2O2S |
|---|---|
| Molecular weight | 232.68 g/mol |
| IUPAC name | (2,2-difluorocyclohexyl)methanesulfonyl chloride |
| InChIKey | UXNSGUYHCFUCJM-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)CS(=O)(=O)Cl)(F)F |
Computed by PubChem (NCBI)