CAS 1780479-64-2 appears in our catalog under these names: 2-(2,2-Difluorocyclopentyl)ethane-1-sulfonyl chloride, 2-(2,2-Difluorocyclopentyl)ethane-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(2,2-difluorocyclopentyl)ethanesulfonyl chloride (CAS 1780479-64-2) is a chemical compound with the molecular formula C7H11ClF2O2S and a molecular weight of 232.68 g/mol. IUPAC name: 2-(2,2-difluorocyclopentyl)ethanesulfonyl chloride. InChIKey: XGFABBBZIGOLFR-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF2O2S |
|---|---|
| Molecular weight | 232.68 g/mol |
| IUPAC name | 2-(2,2-difluorocyclopentyl)ethanesulfonyl chloride |
| InChIKey | XGFABBBZIGOLFR-UHFFFAOYSA-N |
| SMILES | C1CC(C(C1)(F)F)CCS(=O)(=O)Cl |
Computed by PubChem (NCBI)