CAS 1691933-77-3 is the registry number for (3,3-Difluorocyclohexyl)methanesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3,3-difluorocyclohexyl)methanesulfonyl chloride (CAS 1691933-77-3) is a chemical compound with the molecular formula C7H11ClF2O2S and a molecular weight of 232.68 g/mol. IUPAC name: (3,3-difluorocyclohexyl)methanesulfonyl chloride. InChIKey: QSPHSERFSNKLAW-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF2O2S |
|---|---|
| Molecular weight | 232.68 g/mol |
| IUPAC name | (3,3-difluorocyclohexyl)methanesulfonyl chloride |
| InChIKey | QSPHSERFSNKLAW-UHFFFAOYSA-N |
| SMILES | C1CC(CC(C1)(F)F)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)