CAS 1566571-52-5 appears in our catalog under these names: 25H–NBOMe (hydrochloride), 2,5-Dimethoxy-N-((2-methoxyphenyl)methyl)benzeneethanamine Hydrochloride, 2-(2,5-Dimethoxyphenyl)-N-(2-methoxybenzyl)ethanamine Hydrochloride, 25H-NB2OMe.HCl, 25H-NB2OMe.HCl, 1mg/ml in Methanol (as free base). Offered by: GLPBio, TRC, Lipomed, Biosynth, MedChemExpress. Available pack sizes: 5mg, 50mg, 10mg, 25mg, 100mg, 1ml, 1mg, 500 μg.
2-(2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine;hydrochloride (CAS 1566571-52-5) is a chemical compound with the molecular formula C18H24ClNO3 and a molecular weight of 337.8 g/mol. IUPAC name: 2-(2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine;hydrochloride. InChIKey: OOFBPLRIHRHTBL-UHFFFAOYSA-N.
| Molecular formula | C18H24ClNO3 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | 2-(2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine;hydrochloride |
| InChIKey | OOFBPLRIHRHTBL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)CCNCC2=CC=CC=C2OC.Cl |
Computed by PubChem (NCBI)