CAS 49745-95-1 appears in our catalog under these names: rac Dobutamine Hydrochloride, >95% (HPLC), rac-Dobutamine Hydrochloride, Dobutamine Hydrochloride, Dobutamine hydrochloride/ 97.15% (existing batch purity), Dobutamine hydrochloride . Offered by: TRC, Hubei YoungXin, Mikromol, TargetMol, Thermo Scientific (Alfa Aesar). Available pack sizes: 100mg, 10mg, 50mg, 25mg, 200mg, 250mg, 500mg, 1g.
4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol;hydrochloride (CAS 49745-95-1) is a chemical compound with the molecular formula C18H24ClNO3 and a molecular weight of 337.8 g/mol. IUPAC name: 4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol;hydrochloride. InChIKey: BQKADKWNRWCIJL-UHFFFAOYSA-N.
| Molecular formula | C18H24ClNO3 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | 4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol;hydrochloride |
| InChIKey | BQKADKWNRWCIJL-UHFFFAOYSA-N |
| SMILES | CC(CCC1=CC=C(C=C1)O)NCCC2=CC(=C(C=C2)O)O.Cl |
Computed by PubChem (NCBI)