Products 90274-24-1
CAS 90274-24-1 appears in our catalog under these names: Ractopamine (hydrochloride), Ractopamine hydrochloride, 96%, Ractopamine hydrochloride, rac Ractopamine Hydrochloride (Mixture of Diastereomers), >95% (HPLC), Ractopamine hydrochloride, 95%. Offered by: GLPBio, Combi-blocks, Dr. Ehrenstorfer, TRC, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 5g, 500mg, 25g, 2g.
4-[3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol;hydrochloride (CAS 90274-24-1) is a chemical compound with the molecular formula C18H24ClNO3 and a molecular weight of 337.8 g/mol. IUPAC name: 4-[3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol;hydrochloride. InChIKey: JHGSLSLUFMZUMK-UHFFFAOYSA-N.
| Molecular formula | C18H24ClNO3 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | 4-[3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol;hydrochloride |
| InChIKey | JHGSLSLUFMZUMK-UHFFFAOYSA-N |
| SMILES | CC(CCC1=CC=C(C=C1)O)NCC(C2=CC=C(C=C2)O)O.Cl |
Computed by PubChem (NCBI)