CAS 74432-68-1 appears in our catalog under these names: Butopamine HCl ((R,R)-Ractopamine HCl), Butopamine (hydrochloride). Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
4-[(3R)-3-[[(2R)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol;hydrochloride (CAS 74432-68-1) is a chemical compound with the molecular formula C18H24ClNO3 and a molecular weight of 337.8 g/mol. IUPAC name: 4-[(3R)-3-[[(2R)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol;hydrochloride. InChIKey: JHGSLSLUFMZUMK-WJKBNZMCSA-N.
| Molecular formula | C18H24ClNO3 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | 4-[(3R)-3-[[(2R)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol;hydrochloride |
| InChIKey | JHGSLSLUFMZUMK-WJKBNZMCSA-N |
| SMILES | C[C@H](CCC1=CC=C(C=C1)O)NC[C@@H](C2=CC=C(C=C2)O)O.Cl |
Computed by PubChem (NCBI)