CAS 1568216-96-5 appears in our catalog under these names: (1S)-1-(5-Bromo-2,3-dihydro-1-benzofuran-7-yl)ethan-1-ol, 95%, (1S)-1-(5-Bromo-2,3-dihydro-1-benzofuran-7-yl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1S)-1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethanol (CAS 1568216-96-5) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: (1S)-1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethanol. InChIKey: NSJZAQQYJDVUEW-LURJTMIESA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | (1S)-1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethanol |
| InChIKey | NSJZAQQYJDVUEW-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC(=CC2=C1OCC2)Br)O |
Computed by PubChem (NCBI)