Products 1568966-89-1

CAS 1568966-89-1 is the registry number for 2-(2-Cyclohexylpyrrolidin-1-yl)acetic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-cyclohexylpyrrolidin-1-yl)acetic acid;hydrochloride (CAS 1568966-89-1) is a chemical compound with the molecular formula C12H22ClNO2 and a molecular weight of 247.76 g/mol. IUPAC name: 2-(2-cyclohexylpyrrolidin-1-yl)acetic acid;hydrochloride. InChIKey: CNSJRCKASSUBHW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22ClNO2
Molecular weight247.76 g/mol
IUPAC name2-(2-cyclohexylpyrrolidin-1-yl)acetic acid;hydrochloride
InChIKeyCNSJRCKASSUBHW-UHFFFAOYSA-N
SMILESC1CCC(CC1)C2CCCN2CC(=O)O.Cl

Computed by PubChem (NCBI)