CAS 2203140-31-0 is the registry number for 4-Dimethylaminomethyl-bicyclo[2.2.2]octane-1-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[(dimethylamino)methyl]bicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride (CAS 2203140-31-0) is a chemical compound with the molecular formula C12H22ClNO2 and a molecular weight of 247.76 g/mol. IUPAC name: 4-[(dimethylamino)methyl]bicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride. InChIKey: LKELDDADBBIWHZ-UHFFFAOYSA-N.
| Molecular formula | C12H22ClNO2 |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | 4-[(dimethylamino)methyl]bicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride |
| InChIKey | LKELDDADBBIWHZ-UHFFFAOYSA-N |
| SMILES | CN(C)CC12CCC(CC1)(CC2)C(=O)O.Cl |
Computed by PubChem (NCBI)