CAS 72422-69-6 is the registry number for Methyl 4-(methylamino)bicyclo[2.2.2]octane-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(dimethylamino)bicyclo[2.2.2]octane-1-carboxylate;hydrochloride (CAS 72422-69-6) is a chemical compound with the molecular formula C12H22ClNO2 and a molecular weight of 247.76 g/mol. IUPAC name: methyl 4-(dimethylamino)bicyclo[2.2.2]octane-1-carboxylate;hydrochloride. InChIKey: ICGGDEBFLLTBMB-UHFFFAOYSA-N.
| Molecular formula | C12H22ClNO2 |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | methyl 4-(dimethylamino)bicyclo[2.2.2]octane-1-carboxylate;hydrochloride |
| InChIKey | ICGGDEBFLLTBMB-UHFFFAOYSA-N |
| SMILES | CN(C)C12CCC(CC1)(CC2)C(=O)OC.Cl |
Computed by PubChem (NCBI)