Products 1956311-18-4

CAS 1956311-18-4 is the registry number for Ethyl 2-azaspiro(4.5)decane-3-carboxylate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-azaspiro[4.5]decane-3-carboxylate;hydrochloride (CAS 1956311-18-4) is a chemical compound with the molecular formula C12H22ClNO2 and a molecular weight of 247.76 g/mol. IUPAC name: ethyl 2-azaspiro[4.5]decane-3-carboxylate;hydrochloride. InChIKey: CVGPSARRUQWWAB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22ClNO2
Molecular weight247.76 g/mol
IUPAC nameethyl 2-azaspiro[4.5]decane-3-carboxylate;hydrochloride
InChIKeyCVGPSARRUQWWAB-UHFFFAOYSA-N
SMILESCCOC(=O)C1CC2(CCCCC2)CN1.Cl

Computed by PubChem (NCBI)