CAS 1569-11-5 appears in our catalog under these names: 7-Methyl-1,8-naphthyridin-2-ol, 2-Hydroxy-7-methyl-1,8-naphthyridine 95%, 2-Hydroxy-7-methyl-1,8-naphthyridine, 95%, 95%, 7-methyl-1,2-dihydro-1,8-naphthyridin-2-one, 95+%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g, 50mg.
7-methyl-1H-1,8-naphthyridin-2-one (CAS 1569-11-5) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 7-methyl-1H-1,8-naphthyridin-2-one. InChIKey: UVBBXHDRJXIQCH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 7-methyl-1H-1,8-naphthyridin-2-one |
| InChIKey | UVBBXHDRJXIQCH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC(=O)N2 |
Computed by PubChem (NCBI)