CAS 1569-18-2 appears in our catalog under these names: 7-Methyl-1,8-naphthyridin-4-ol, 95+%, 7-Methyl-1,8-naphthyridin-4-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-methyl-1H-1,8-naphthyridin-4-one (CAS 1569-18-2) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 7-methyl-1H-1,8-naphthyridin-4-one. InChIKey: JVJJTRYGAHJGAZ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 7-methyl-1H-1,8-naphthyridin-4-one |
| InChIKey | JVJJTRYGAHJGAZ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=O)C=CN2 |
Computed by PubChem (NCBI)