CAS 1569510-08-2 appears in our catalog under these names: 6-Bromo-4-hydroxy-1,5-naphthyridin-2(1H)-one, 97%, 6-Bromo-4-hydroxy-1,2-dihydro-1,5-naphthyridin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-bromo-4-hydroxy-1H-1,5-naphthyridin-2-one (CAS 1569510-08-2) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 6-bromo-4-hydroxy-1H-1,5-naphthyridin-2-one. InChIKey: IVVRRZNIUKNOFM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 6-bromo-4-hydroxy-1H-1,5-naphthyridin-2-one |
| InChIKey | IVVRRZNIUKNOFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC(=O)C=C2O)Br |
Computed by PubChem (NCBI)