Products 157110-18-4
CAS 157110-18-4 is the registry number for Ajuforrestin A, 98%, ≥98%. Offered by: Chemat. Available pack sizes: 10mg.
7,11-dihydroxy-3,4,8,11b-tetramethyl-1,2-dihydronaphtho[2,1-f][1]benzofuran-6-one (CAS 157110-18-4) is a chemical compound with the molecular formula C20H20O4 and a molecular weight of 324.4 g/mol. IUPAC name: 7,11-dihydroxy-3,4,8,11b-tetramethyl-1,2-dihydronaphtho[2,1-f][1]benzofuran-6-one. InChIKey: VGDAVGPDHBMHBW-UHFFFAOYSA-N.
| Molecular formula | C20H20O4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 7,11-dihydroxy-3,4,8,11b-tetramethyl-1,2-dihydronaphtho[2,1-f][1]benzofuran-6-one |
| InChIKey | VGDAVGPDHBMHBW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC(=O)C3=C(C2(CC1)C)C(=C4C(=C3O)C(=CO4)C)O)C |
Computed by PubChem (NCBI)