CAS 157253-80-0 is the registry number for 10,11-Didehydrocinchonidine. Offered by: TRC. Available pack sizes: 1g.
(R)-[(2S,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (CAS 157253-80-0) is a chemical compound with the molecular formula C19H20N2O and a molecular weight of 292.4 g/mol. IUPAC name: (R)-[(2S,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol. InChIKey: SNHVPLAWDVTWHD-KODHJQJWSA-N.
| Molecular formula | C19H20N2O |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | (R)-[(2S,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| InChIKey | SNHVPLAWDVTWHD-KODHJQJWSA-N |
| SMILES | C#C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](C3=CC=NC4=CC=CC=C34)O |
Computed by PubChem (NCBI)