Products 210408-26-7
CAS 210408-26-7 is the registry number for Mebhydrolin N-Oxide. Offered by: Mikromol. Available pack sizes: 25mg.
5-benzyl-2-methyl-2-oxido-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium (CAS 210408-26-7) is a chemical compound with the molecular formula C19H20N2O and a molecular weight of 292.4 g/mol. IUPAC name: 5-benzyl-2-methyl-2-oxido-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium. InChIKey: ZDBGXQJKFLJWRJ-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 5-benzyl-2-methyl-2-oxido-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium |
| InChIKey | ZDBGXQJKFLJWRJ-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCC2=C(C1)C3=CC=CC=C3N2CC4=CC=CC=C4)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Mebhydrolin N-oxide