CAS 15727-80-7 appears in our catalog under these names: Allyl 4-nitrobenzoate, 95%, Allyl 4-nitrobenzoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g.
Prop-2-enyl 4-nitrobenzoate (CAS 15727-80-7) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: prop-2-enyl 4-nitrobenzoate. InChIKey: FNAOSVAQWXBRLK-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | prop-2-enyl 4-nitrobenzoate |
| InChIKey | FNAOSVAQWXBRLK-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)