CAS 15733-84-3 appears in our catalog under these names: 6-Methylquinoline-2-carboxylic acid, 95%, 6-Methylquinoline-2-carboxylic acid, 98%, 6–Methylquinoline–2–carboxylic acid, 6-Methylquinoline-2-Carboxylic Acid, 6-Methylquinoline-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 0,5g, 50mg, 500mg.
6-methylquinoline-2-carboxylic acid (CAS 15733-84-3) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 6-methylquinoline-2-carboxylic acid. InChIKey: WPEQJEGNZGMHEZ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 6-methylquinoline-2-carboxylic acid |
| InChIKey | WPEQJEGNZGMHEZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)