CAS 2374838-89-6 is the registry number for 5-(Benzyloxy)-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-phenylmethoxy-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (CAS 2374838-89-6) is a chemical compound with the molecular formula C14H13N3O3 and a molecular weight of 271.27 g/mol. IUPAC name: 5-phenylmethoxy-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione. InChIKey: BAOVESXEKIXIDD-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O3 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 5-phenylmethoxy-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| InChIKey | BAOVESXEKIXIDD-UHFFFAOYSA-N |
| SMILES | C1NC(=O)C2=C(C(=O)C=CN2N1)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)